C13H21N3O4S — CID 139066606
N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]acetamide;hydrate (PubChem CID 139066606) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]acetamide;hydrate.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]acetamide;hydrate |
|---|---|
| PubChem CID | 139066606 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]acetamide;hydrate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1.O |
| InChI | InChI=1S/C13H19N3O3S.H2O/c1-11(17)14-12-3-5-13(6-4-12)20(18,19)16-9-7-15(2)8-10-16;/h3-6H,7-10H2,1-2H3,(H,14,17);1H2 |
| InChIKey | JPWQMPNACWAPAJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |