C12H15N3O4S — CID 75401190
N-[4-(3-methyl-4-oxoimidazolidin-1-yl)sulfonylphenyl]acetamide (PubChem CID 75401190) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[4-(3-methyl-4-oxoimidazolidin-1-yl)sulfonylphenyl]acetamide.
| Compound Name | N-[4-(3-methyl-4-oxoimidazolidin-1-yl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 75401190 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[4-(3-methyl-4-oxoimidazolidin-1-yl)sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CC(=O)N(C)C2)cc1 |
| InChI | InChI=1S/C12H15N3O4S/c1-9(16)13-10-3-5-11(6-4-10)20(18,19)15-7-12(17)14(2)8-15/h3-6H,7-8H2,1-2H3,(H,13,16) |
| InChIKey | HWZPNFGXYOZUNV-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |