C16H20N4O5S — CID 27396707
N-[4-[(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)sulfonyl]phenyl]acetamide (PubChem CID 27396707) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[4-[(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 27396707 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[4-[(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC3(CC2)NC(=O)N(C)C3=O)cc1 |
| InChI | InChI=1S/C16H20N4O5S/c1-11(21)17-12-3-5-13(6-4-12)26(24,25)20-9-7-16(8-10-20)14(22)19(2)15(23)18-16/h3-6H,7-10H2,1-2H3,(H,17,21)(H,18,23) |
| InChIKey | HBCGNSZHKRSCRH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|