C15H21N3O4S — CID 3573154
N-[4-[(4-acetyl-1,4-diazepan-1-yl)sulfonyl]phenyl]acetamide (PubChem CID 3573154) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[4-[(4-acetyl-1,4-diazepan-1-yl)sulfonyl]phenyl]acetamide.
| Compound Name | N-[4-[(4-acetyl-1,4-diazepan-1-yl)sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 3573154 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[4-[(4-acetyl-1,4-diazepan-1-yl)sulfonyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C15H21N3O4S/c1-12(19)16-14-4-6-15(7-5-14)23(21,22)18-9-3-8-17(10-11-18)13(2)20/h4-7H,3,8-11H2,1-2H3,(H,16,19) |
| InChIKey | CIWFDBGYXGDPPL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |