C14H19ClN2O3S — CID 3831126
1-[4-(3-chloro-4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]ethanone (PubChem CID 3831126) has the molecular formula C14H19ClN2O3S and a molecular weight of 330.84 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(3-chloro-4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 3831126 |
| Molecular Formula | C14H19ClN2O3S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-[4-(3-chloro-4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(S(=O)(=O)c2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H19ClN2O3S/c1-11-4-5-13(10-14(11)15)21(19,20)17-7-3-6-16(8-9-17)12(2)18/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | IOZJQGPIKZFZNS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |