C13H16Cl2N2O3S — CID 3752352
1-[4-(3,5-dichlorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanone (PubChem CID 3752352) has the molecular formula C13H16Cl2N2O3S and a molecular weight of 351.26 g/mol. Its IUPAC name is 1-[4-(3,5-dichlorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(3,5-dichlorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 3752352 |
| Molecular Formula | C13H16Cl2N2O3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 1-[4-(3,5-dichlorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(S(=O)(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H16Cl2N2O3S/c1-10(18)16-3-2-4-17(6-5-16)21(19,20)13-8-11(14)7-12(15)9-13/h7-9H,2-6H2,1H3 |
| InChIKey | RSMHOQPGFKDADL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |