C14H19BrN2O3S — CID 65482014
1-[4-[4-(bromomethyl)phenyl]sulfonyl-1,4-diazepan-1-yl]ethanone (PubChem CID 65482014) has the molecular formula C14H19BrN2O3S and a molecular weight of 375.29 g/mol. Its IUPAC name is 1-[4-[4-(bromomethyl)phenyl]sulfonyl-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-[4-(bromomethyl)phenyl]sulfonyl-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 65482014 |
| Molecular Formula | C14H19BrN2O3S |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 1-[4-[4-(bromomethyl)phenyl]sulfonyl-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(S(=O)(=O)c2ccc(CBr)cc2)CC1 |
| InChI | InChI=1S/C14H19BrN2O3S/c1-12(18)16-7-2-8-17(10-9-16)21(19,20)14-5-3-13(11-15)4-6-14/h3-6H,2,7-11H2,1H3 |
| InChIKey | ZVVOAPRGSSIWTP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|