C18H26N2O4S — CID 110796362
1-[4-(4-cyclopentyloxyphenyl)sulfonyl-1,4-diazepan-1-yl]ethanone (PubChem CID 110796362) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 1-[4-(4-cyclopentyloxyphenyl)sulfonyl-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(4-cyclopentyloxyphenyl)sulfonyl-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 110796362 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[4-(4-cyclopentyloxyphenyl)sulfonyl-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(S(=O)(=O)c2ccc(OC3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C18H26N2O4S/c1-15(21)19-11-4-12-20(14-13-19)25(22,23)18-9-7-17(8-10-18)24-16-5-2-3-6-16/h7-10,16H,2-6,11-14H2,1H3 |
| InChIKey | VQMOQMVSDXGLRS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |