C14H19NO4S — CID 110740083
3-(4-cyclopentyloxyphenyl)sulfonyl-1,3-oxazolidine (PubChem CID 110740083) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-(4-cyclopentyloxyphenyl)sulfonyl-1,3-oxazolidine.
| Compound Name | 3-(4-cyclopentyloxyphenyl)sulfonyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740083 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-(4-cyclopentyloxyphenyl)sulfonyl-1,3-oxazolidine |
| SMILES | O=S(=O)(c1ccc(OC2CCCC2)cc1)N1CCOC1 |
| InChI | InChI=1S/C14H19NO4S/c16-20(17,15-9-10-18-11-15)14-7-5-13(6-8-14)19-12-3-1-2-4-12/h5-8,12H,1-4,9-11H2 |
| InChIKey | YIXOURWLIGMFGY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |