C11H15NO4S — CID 110740101
3-(4-ethoxyphenyl)sulfonyl-1,3-oxazolidine (PubChem CID 110740101) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)sulfonyl-1,3-oxazolidine.
| Compound Name | 3-(4-ethoxyphenyl)sulfonyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740101 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-(4-ethoxyphenyl)sulfonyl-1,3-oxazolidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCOC2)cc1 |
| InChI | InChI=1S/C11H15NO4S/c1-2-16-10-3-5-11(6-4-10)17(13,14)12-7-8-15-9-12/h3-6H,2,7-9H2,1H3 |
| InChIKey | KTIXTGPHROAWEM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |