C21H32N2O4S — CID 170120954
4-[8-(4-ethoxyphenyl)sulfonyl-8-azaspiro[4.5]decan-3-yl]morpholine (PubChem CID 170120954) has the molecular formula C21H32N2O4S and a molecular weight of 408.56 g/mol. Its IUPAC name is 4-[8-(4-ethoxyphenyl)sulfonyl-8-azaspiro[4.5]decan-3-yl]morpholine.
| Compound Name | 4-[8-(4-ethoxyphenyl)sulfonyl-8-azaspiro[4.5]decan-3-yl]morpholine |
|---|---|
| PubChem CID | 170120954 |
| Molecular Formula | C21H32N2O4S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 4-[8-(4-ethoxyphenyl)sulfonyl-8-azaspiro[4.5]decan-3-yl]morpholine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC3(CCC(N4CCOCC4)C3)CC2)cc1 |
| InChI | InChI=1S/C21H32N2O4S/c1-2-27-19-3-5-20(6-4-19)28(24,25)23-11-9-21(10-12-23)8-7-18(17-21)22-13-15-26-16-14-22/h3-6,18H,2,7-17H2,1H3 |
| InChIKey | KRPXKZKGGVEPID-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |