C17H19NO4S — CID 110870648
4-(4-ethoxyphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 110870648) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzoxazepine.
| Compound Name | 4-(4-ethoxyphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 110870648 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-(4-ethoxyphenyl)sulfonyl-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCOc3ccccc3C2)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-2-21-15-7-9-16(10-8-15)23(19,20)18-11-12-22-17-6-4-3-5-14(17)13-18/h3-10H,2,11-13H2,1H3 |
| InChIKey | NIBMZXUXNFPIDF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |