C16H22N2O4S — CID 110727956
1-(4-cyclopentyloxyphenyl)sulfonyl-1,4-diazepan-5-one (PubChem CID 110727956) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)sulfonyl-1,4-diazepan-5-one.
| Compound Name | 1-(4-cyclopentyloxyphenyl)sulfonyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 110727956 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)sulfonyl-1,4-diazepan-5-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccc(OC3CCCC3)cc2)CCN1 |
| InChI | InChI=1S/C16H22N2O4S/c19-16-9-11-18(12-10-17-16)23(20,21)15-7-5-14(6-8-15)22-13-3-1-2-4-13/h5-8,13H,1-4,9-12H2,(H,17,19) |
| InChIKey | FKIRNQXXJHVTAJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |