C16H15FN2O4S — CID 142635977
1-[4-(4-fluorophenoxy)phenyl]sulfonyl-1,3-diazinan-4-one (PubChem CID 142635977) has the molecular formula C16H15FN2O4S and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-[4-(4-fluorophenoxy)phenyl]sulfonyl-1,3-diazinan-4-one.
| Compound Name | 1-[4-(4-fluorophenoxy)phenyl]sulfonyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 142635977 |
| Molecular Formula | C16H15FN2O4S |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 1-[4-(4-fluorophenoxy)phenyl]sulfonyl-1,3-diazinan-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccc(Oc3ccc(F)cc3)cc2)CN1 |
| InChI | InChI=1S/C16H15FN2O4S/c17-12-1-3-13(4-2-12)23-14-5-7-15(8-6-14)24(21,22)19-10-9-16(20)18-11-19/h1-8H,9-11H2,(H,18,20) |
| InChIKey | GBGDZEZJSACNLV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |