C14H13FN2O2S — CID 61045177
6-(4-fluorophenyl)sulfonyl-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 61045177) has the molecular formula C14H13FN2O2S and a molecular weight of 292.34 g/mol. Its IUPAC name is 6-(4-fluorophenyl)sulfonyl-7,8-dihydro-5H-1,6-naphthyridine.
| Compound Name | 6-(4-fluorophenyl)sulfonyl-7,8-dihydro-5H-1,6-naphthyridine |
|---|---|
| PubChem CID | 61045177 |
| Molecular Formula | C14H13FN2O2S |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 6-(4-fluorophenyl)sulfonyl-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCc2ncccc2C1 |
| InChI | InChI=1S/C14H13FN2O2S/c15-12-3-5-13(6-4-12)20(18,19)17-9-7-14-11(10-17)2-1-8-16-14/h1-6,8H,7,9-10H2 |
| InChIKey | LMZMYVHQWYYBEL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |