C11H12F2N2O3S — CID 60709305
1-(3,5-difluorophenyl)sulfonyl-1,4-diazepan-5-one (PubChem CID 60709305) has the molecular formula C11H12F2N2O3S and a molecular weight of 290.29 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)sulfonyl-1,4-diazepan-5-one.
| Compound Name | 1-(3,5-difluorophenyl)sulfonyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 60709305 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-(3,5-difluorophenyl)sulfonyl-1,4-diazepan-5-one |
| SMILES | O=C1CCN(S(=O)(=O)c2cc(F)cc(F)c2)CCN1 |
| InChI | InChI=1S/C11H12F2N2O3S/c12-8-5-9(13)7-10(6-8)19(17,18)15-3-1-11(16)14-2-4-15/h5-7H,1-4H2,(H,14,16) |
| InChIKey | NFXJZHBDRDBIKK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |