C11H12FN3O5S — CID 60709339
1-(4-fluoro-3-nitrophenyl)sulfonyl-1,4-diazepan-5-one (PubChem CID 60709339) has the molecular formula C11H12FN3O5S and a molecular weight of 317.30 g/mol. Its IUPAC name is 1-(4-fluoro-3-nitrophenyl)sulfonyl-1,4-diazepan-5-one.
| Compound Name | 1-(4-fluoro-3-nitrophenyl)sulfonyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 60709339 |
| Molecular Formula | C11H12FN3O5S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-(4-fluoro-3-nitrophenyl)sulfonyl-1,4-diazepan-5-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccc(F)c([N+](=O)[O-])c2)CCN1 |
| InChI | InChI=1S/C11H12FN3O5S/c12-9-2-1-8(7-10(9)15(17)18)21(19,20)14-5-3-11(16)13-4-6-14/h1-2,7H,3-6H2,(H,13,16) |
| InChIKey | PWXUYIBLIUVHFK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|