C11H14N4O5S — CID 62999028
1-(2-amino-5-nitrophenyl)sulfonyl-1,4-diazepan-5-one (PubChem CID 62999028) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-(2-amino-5-nitrophenyl)sulfonyl-1,4-diazepan-5-one.
| Compound Name | 1-(2-amino-5-nitrophenyl)sulfonyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62999028 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-(2-amino-5-nitrophenyl)sulfonyl-1,4-diazepan-5-one |
| SMILES | Nc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C11H14N4O5S/c12-9-2-1-8(15(17)18)7-10(9)21(19,20)14-5-3-11(16)13-4-6-14/h1-2,7H,3-6,12H2,(H,13,16) |
| InChIKey | YLPOHQICZYFEKV-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|