C9H13N5O5S2 — CID 80744776
1-(5-hydrazinyl-4-nitrothiophen-2-yl)sulfonyl-1,4-diazepan-5-one (PubChem CID 80744776) has the molecular formula C9H13N5O5S2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 1-(5-hydrazinyl-4-nitrothiophen-2-yl)sulfonyl-1,4-diazepan-5-one.
| Compound Name | 1-(5-hydrazinyl-4-nitrothiophen-2-yl)sulfonyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 80744776 |
| Molecular Formula | C9H13N5O5S2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 1-(5-hydrazinyl-4-nitrothiophen-2-yl)sulfonyl-1,4-diazepan-5-one |
| SMILES | NNc1sc(S(=O)(=O)N2CCNC(=O)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N5O5S2/c10-12-9-6(14(16)17)5-8(20-9)21(18,19)13-3-1-7(15)11-2-4-13/h5,12H,1-4,10H2,(H,11,15) |
| InChIKey | ALWYFFDCXYWLKE-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|