C11H13N3O5S — CID 37496718
4-(2-methyl-4-nitrophenyl)sulfonylpiperazin-2-one (PubChem CID 37496718) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is 4-(2-methyl-4-nitrophenyl)sulfonylpiperazin-2-one.
| Compound Name | 4-(2-methyl-4-nitrophenyl)sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 37496718 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-(2-methyl-4-nitrophenyl)sulfonylpiperazin-2-one |
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C11H13N3O5S/c1-8-6-9(14(16)17)2-3-10(8)20(18,19)13-5-4-12-11(15)7-13/h2-3,6H,4-5,7H2,1H3,(H,12,15) |
| InChIKey | IEOLKCLLCCOZMH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|