C12H15BrN2O3S — CID 131963610
1-(4-bromo-2-methylphenyl)sulfonyl-1,4-diazepan-5-one (PubChem CID 131963610) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)sulfonyl-1,4-diazepan-5-one.
| Compound Name | 1-(4-bromo-2-methylphenyl)sulfonyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 131963610 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)sulfonyl-1,4-diazepan-5-one |
| SMILES | Cc1cc(Br)ccc1S(=O)(=O)N1CCNC(=O)CC1 |
| InChI | InChI=1S/C12H15BrN2O3S/c1-9-8-10(13)2-3-11(9)19(17,18)15-6-4-12(16)14-5-7-15/h2-3,8H,4-7H2,1H3,(H,14,16) |
| InChIKey | BABBOACEWPLSCM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |