C15H24ClN3O4S — CID 120718273
N-methyl-2-[1-(2-methyl-4-nitrophenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride (PubChem CID 120718273) has the molecular formula C15H24ClN3O4S and a molecular weight of 377.89 g/mol. Its IUPAC name is N-methyl-2-[1-(2-methyl-4-nitrophenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | N-methyl-2-[1-(2-methyl-4-nitrophenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120718273 |
| Molecular Formula | C15H24ClN3O4S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-methyl-2-[1-(2-methyl-4-nitrophenyl)sulfonylpiperidin-4-yl]ethanamine;hydrochloride |
| SMILES | CNCCC1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2C)CC1.Cl |
| InChI | InChI=1S/C15H23N3O4S.ClH/c1-12-11-14(18(19)20)3-4-15(12)23(21,22)17-9-6-13(7-10-17)5-8-16-2;/h3-4,11,13,16H,5-10H2,1-2H3;1H |
| InChIKey | GUYDSTDIVODZLG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|