C10H16ClN3O4S — CID 119973287
2-methyl-N-[2-(methylamino)ethyl]-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119973287) has the molecular formula C10H16ClN3O4S and a molecular weight of 309.78 g/mol. Its IUPAC name is 2-methyl-N-[2-(methylamino)ethyl]-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | 2-methyl-N-[2-(methylamino)ethyl]-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973287 |
| Molecular Formula | C10H16ClN3O4S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-methyl-N-[2-(methylamino)ethyl]-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1C.Cl |
| InChI | InChI=1S/C10H15N3O4S.ClH/c1-8-7-9(13(14)15)3-4-10(8)18(16,17)12-6-5-11-2;/h3-4,7,11-12H,5-6H2,1-2H3;1H |
| InChIKey | MODHBUWFCJRXLS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|