C12H20ClN3O4S — CID 119965087
2,3-dimethyl-N-[3-(methylamino)propyl]-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119965087) has the molecular formula C12H20ClN3O4S and a molecular weight of 337.83 g/mol. Its IUPAC name is 2,3-dimethyl-N-[3-(methylamino)propyl]-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | 2,3-dimethyl-N-[3-(methylamino)propyl]-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119965087 |
| Molecular Formula | C12H20ClN3O4S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2,3-dimethyl-N-[3-(methylamino)propyl]-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1cc([N+](=O)[O-])cc(C)c1C.Cl |
| InChI | InChI=1S/C12H19N3O4S.ClH/c1-9-7-11(15(16)17)8-12(10(9)2)20(18,19)14-6-4-5-13-3;/h7-8,13-14H,4-6H2,1-3H3;1H |
| InChIKey | DUBMJSHHFKBPLQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|