C12H21ClN2O2S — CID 119965080
2,5-dimethyl-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride (PubChem CID 119965080) has the molecular formula C12H21ClN2O2S and a molecular weight of 292.83 g/mol. Its IUPAC name is 2,5-dimethyl-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride.
| Compound Name | 2,5-dimethyl-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119965080 |
| Molecular Formula | C12H21ClN2O2S |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2,5-dimethyl-N-[3-(methylamino)propyl]benzenesulfonamide;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)c1cc(C)ccc1C.Cl |
| InChI | InChI=1S/C12H20N2O2S.ClH/c1-10-5-6-11(2)12(9-10)17(15,16)14-8-4-7-13-3;/h5-6,9,13-14H,4,7-8H2,1-3H3;1H |
| InChIKey | KPDKPLZRXGZKIK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|