C13H21NO3S — CID 107271098
N-(4-hydroxypentyl)-2,5-dimethylbenzenesulfonamide (PubChem CID 107271098) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is N-(4-hydroxypentyl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(4-hydroxypentyl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107271098 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(4-hydroxypentyl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCCC(C)O)c1 |
| InChI | InChI=1S/C13H21NO3S/c1-10-6-7-11(2)13(9-10)18(16,17)14-8-4-5-12(3)15/h6-7,9,12,14-15H,4-5,8H2,1-3H3 |
| InChIKey | UBJAANPRZFVEEK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|