C10H14N2O3S — CID 9189431
2-[(2,5-dimethylphenyl)sulfonylamino]acetamide (PubChem CID 9189431) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfonylamino]acetamide.
| Compound Name | 2-[(2,5-dimethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 9189431 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC(N)=O)c1 |
| InChI | InChI=1S/C10H14N2O3S/c1-7-3-4-8(2)9(5-7)16(14,15)12-6-10(11)13/h3-5,12H,6H2,1-2H3,(H2,11,13) |
| InChIKey | OXONOHCCAZJAOR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |