C17H19NO5S — CID 139957937
2-[(2,5-dimethylphenyl)sulfonylamino]ethyl 4-hydroxybenzoate (PubChem CID 139957937) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfonylamino]ethyl 4-hydroxybenzoate.
| Compound Name | 2-[(2,5-dimethylphenyl)sulfonylamino]ethyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 139957937 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfonylamino]ethyl 4-hydroxybenzoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCOC(=O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C17H19NO5S/c1-12-3-4-13(2)16(11-12)24(21,22)18-9-10-23-17(20)14-5-7-15(19)8-6-14/h3-8,11,18-19H,9-10H2,1-2H3 |
| InChIKey | FJTBHSPALLKZPW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|