About (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide
(2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide (PubChem CID 35644810) has the molecular formula C18H23N3O3S
and a molecular weight of 361.47 g/mol. Its IUPAC name is (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide.
Molecular Properties
| Compound Name | (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide |
| PubChem CID | 35644810 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCN[C@@H](C(N)=O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H23N3O3S/c1-13-8-9-14(2)16(12-13)25(23,24)21-11-10-20-17(18(19)22)15-6-4-3-5-7-15/h3-9,12,17,20-21H,10-11H2,1-2H3,(H2,19,22)/t17-/m1/s1 |
| InChIKey | PSNMWLTWOAPKSF-QGZVFWFLSA-N |
| XLogP | 1.40 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide?
The IUPAC name of (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide (CID 35644810) is (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide.
What is the SMILES notation for (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide?
The canonical SMILES for (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide is Cc1ccc(C)c(S(=O)(=O)NCCN[C@@H](C(N)=O)c2ccccc2)c1.
What is the InChIKey of (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide?
The InChIKey is PSNMWLTWOAPKSF-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H23N3O3S/c1-13-8-9-14(2)16(12-13)25(23,24)21-11-10-20-17(18(19)22)15-6-4-3-5-7-15/h3-9,12,17,20-21H,10-11H2,1-2H3,(H2,19,22)/t17-/m1/s1.
What are the key properties of (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide?
(2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide has a molecular weight of 361.47 g/mol, XLogP of 1.40, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[2-[(2,5-dimethylphenyl)sulfonylamino]ethylamino]-2-phenylacetamide is sourced from PubChem (CID 35644810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).