C12H18N2O — CID 14569005
2-(butylamino)-2-phenylacetamide (PubChem CID 14569005) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(butylamino)-2-phenylacetamide.
| Compound Name | 2-(butylamino)-2-phenylacetamide |
|---|---|
| PubChem CID | 14569005 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(butylamino)-2-phenylacetamide |
| SMILES | CCCCNC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C12H18N2O/c1-2-3-9-14-11(12(13)15)10-7-5-4-6-8-10/h4-8,11,14H,2-3,9H2,1H3,(H2,13,15) |
| InChIKey | KNTIDVSWVXVRRF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|