C21H27BrN2O4 — CID 54603034
2-[5-[[carboxy(phenyl)methyl]amino]pentylamino]-2-phenylacetic acid;hydrobromide (PubChem CID 54603034) has the molecular formula C21H27BrN2O4 and a molecular weight of 451.36 g/mol. Its IUPAC name is 2-[5-[[carboxy(phenyl)methyl]amino]pentylamino]-2-phenylacetic acid;hydrobromide.
| Compound Name | 2-[5-[[carboxy(phenyl)methyl]amino]pentylamino]-2-phenylacetic acid;hydrobromide |
|---|---|
| PubChem CID | 54603034 |
| Molecular Formula | C21H27BrN2O4 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-[5-[[carboxy(phenyl)methyl]amino]pentylamino]-2-phenylacetic acid;hydrobromide |
| SMILES | Br.O=C(O)C(NCCCCCNC(C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O4.BrH/c24-20(25)18(16-10-4-1-5-11-16)22-14-8-3-9-15-23-19(21(26)27)17-12-6-2-7-13-17;/h1-2,4-7,10-13,18-19,22-23H,3,8-9,14-15H2,(H,24,25)(H,26,27);1H |
| InChIKey | VZPLQPNFAGOPRG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|