C19H20F3NO2 — CID 122038559
(2S)-2-phenyl-2-[4-[3-(trifluoromethyl)phenyl]butylamino]acetic acid (PubChem CID 122038559) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is (2S)-2-phenyl-2-[4-[3-(trifluoromethyl)phenyl]butylamino]acetic acid.
| Compound Name | (2S)-2-phenyl-2-[4-[3-(trifluoromethyl)phenyl]butylamino]acetic acid |
|---|---|
| PubChem CID | 122038559 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (2S)-2-phenyl-2-[4-[3-(trifluoromethyl)phenyl]butylamino]acetic acid |
| SMILES | O=C(O)[C@@H](NCCCCc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H20F3NO2/c20-19(21,22)16-11-6-8-14(13-16)7-4-5-12-23-17(18(24)25)15-9-2-1-3-10-15/h1-3,6,8-11,13,17,23H,4-5,7,12H2,(H,24,25)/t17-/m0/s1 |
| InChIKey | CCVLKJFAOKWNMF-KRWDZBQOSA-N |
| XLogP | 4.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|