C13H18F3NO3S2 — CID 154347902
1-[4-(2-sulfosulfanylethylamino)butyl]-3-(trifluoromethyl)benzene (PubChem CID 154347902) has the molecular formula C13H18F3NO3S2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 1-[4-(2-sulfosulfanylethylamino)butyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[4-(2-sulfosulfanylethylamino)butyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 154347902 |
| Molecular Formula | C13H18F3NO3S2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 1-[4-(2-sulfosulfanylethylamino)butyl]-3-(trifluoromethyl)benzene |
| SMILES | O=S(=O)(O)SCCNCCCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NO3S2/c14-13(15,16)12-6-3-5-11(10-12)4-1-2-7-17-8-9-21-22(18,19)20/h3,5-6,10,17H,1-2,4,7-9H2,(H,18,19,20) |
| InChIKey | PYLPUUKEGSNNCF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|