C12H15F3N2O3 — CID 87514540
hydroxy-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]carbamic acid (PubChem CID 87514540) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is hydroxy-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]carbamic acid.
| Compound Name | hydroxy-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]carbamic acid |
|---|---|
| PubChem CID | 87514540 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | hydroxy-[3-[[3-(trifluoromethyl)phenyl]methylamino]propyl]carbamic acid |
| SMILES | O=C(O)N(O)CCCNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O3/c13-12(14,15)10-4-1-3-9(7-10)8-16-5-2-6-17(20)11(18)19/h1,3-4,7,16,20H,2,5-6,8H2,(H,18,19) |
| InChIKey | KZBKJNGIRDPNCT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|