C11H13F3N2O — CID 43090002
3-[[3-(trifluoromethyl)phenyl]methylamino]propanamide (PubChem CID 43090002) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)phenyl]methylamino]propanamide.
| Compound Name | 3-[[3-(trifluoromethyl)phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 43090002 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-[[3-(trifluoromethyl)phenyl]methylamino]propanamide |
| SMILES | NC(=O)CCNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O/c12-11(13,14)9-3-1-2-8(6-9)7-16-5-4-10(15)17/h1-3,6,16H,4-5,7H2,(H2,15,17) |
| InChIKey | XOHUETWXABTEAA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|