C17H16BrF3 — CID 64506557
1-(4-bromo-4-phenylbutyl)-3-(trifluoromethyl)benzene (PubChem CID 64506557) has the molecular formula C17H16BrF3 and a molecular weight of 357.21 g/mol. Its IUPAC name is 1-(4-bromo-4-phenylbutyl)-3-(trifluoromethyl)benzene.
| Compound Name | 1-(4-bromo-4-phenylbutyl)-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 64506557 |
| Molecular Formula | C17H16BrF3 |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 1-(4-bromo-4-phenylbutyl)-3-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cccc(CCCC(Br)c2ccccc2)c1 |
| InChI | InChI=1S/C17H16BrF3/c18-16(14-8-2-1-3-9-14)11-5-7-13-6-4-10-15(12-13)17(19,20)21/h1-4,6,8-10,12,16H,5,7,11H2 |
| InChIKey | SEXGJDOKGHVBPY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|