C18H19F3O2 — CID 175116158
4-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxy]butan-1-ol (PubChem CID 175116158) has the molecular formula C18H19F3O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxy]butan-1-ol.
| Compound Name | 4-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxy]butan-1-ol |
|---|---|
| PubChem CID | 175116158 |
| Molecular Formula | C18H19F3O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxy]butan-1-ol |
| SMILES | OCCCC(OCc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H19F3O2/c19-18(20,21)16-9-4-6-14(12-16)13-23-17(10-5-11-22)15-7-2-1-3-8-15/h1-4,6-9,12,17,22H,5,10-11,13H2 |
| InChIKey | CLPJOIXXXIHTGQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |