C24H24F3NO — CID 130253876
(2R)-2-phenyl-2-[[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]methoxy]ethanamine (PubChem CID 130253876) has the molecular formula C24H24F3NO and a molecular weight of 399.46 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]methoxy]ethanamine.
| Compound Name | (2R)-2-phenyl-2-[[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]methoxy]ethanamine |
|---|---|
| PubChem CID | 130253876 |
| Molecular Formula | C24H24F3NO |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (2R)-2-phenyl-2-[[4-[2-[4-(trifluoromethyl)phenyl]ethyl]phenyl]methoxy]ethanamine |
| SMILES | NC[C@H](OCc1ccc(CCc2ccc(C(F)(F)F)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H24F3NO/c25-24(26,27)22-14-12-19(13-15-22)7-6-18-8-10-20(11-9-18)17-29-23(16-28)21-4-2-1-3-5-21/h1-5,8-15,23H,6-7,16-17,28H2/t23-/m0/s1 |
| InChIKey | IRGSJOIWAZCNDF-QHCPKHFHSA-N |
| XLogP | 5.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |