C18H16F3NO2 — CID 40521590
(3S,4Z)-3-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-one (PubChem CID 40521590) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is (3S,4Z)-3-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-one.
| Compound Name | (3S,4Z)-3-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-one |
|---|---|
| PubChem CID | 40521590 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (3S,4Z)-3-phenyl-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-one |
| SMILES | CC(=O)[C@H](/C=N\OCc1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H16F3NO2/c1-13(23)17(15-7-3-2-4-8-15)11-22-24-12-14-6-5-9-16(10-14)18(19,20)21/h2-11,17H,12H2,1H3/b22-11-/t17-/m0/s1 |
| InChIKey | HMWXUEXAYBJVBM-SXOHWRJOSA-N |
| XLogP | 4.58 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|