C13H13F3O3 — CID 66765026
3-hydroxy-6-[3-(trifluoromethyl)phenyl]hexane-2,4-dione (PubChem CID 66765026) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is 3-hydroxy-6-[3-(trifluoromethyl)phenyl]hexane-2,4-dione.
| Compound Name | 3-hydroxy-6-[3-(trifluoromethyl)phenyl]hexane-2,4-dione |
|---|---|
| PubChem CID | 66765026 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-hydroxy-6-[3-(trifluoromethyl)phenyl]hexane-2,4-dione |
| SMILES | CC(=O)C(O)C(=O)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3O3/c1-8(17)12(19)11(18)6-5-9-3-2-4-10(7-9)13(14,15)16/h2-4,7,12,19H,5-6H2,1H3 |
| InChIKey | PJDQBHGDFIXLAM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|