C13H17F3O — CID 55134975
1-[3-(trifluoromethyl)phenyl]hexan-3-ol (PubChem CID 55134975) has the molecular formula C13H17F3O and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]hexan-3-ol.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]hexan-3-ol |
|---|---|
| PubChem CID | 55134975 |
| Molecular Formula | C13H17F3O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]hexan-3-ol |
| SMILES | CCCC(O)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3O/c1-2-4-12(17)8-7-10-5-3-6-11(9-10)13(14,15)16/h3,5-6,9,12,17H,2,4,7-8H2,1H3 |
| InChIKey | RGBKVTVOQUCOJZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |