C14H17F3O2 — CID 157381278
tert-butyl 3-[3-(trifluoromethyl)phenyl]propanoate (PubChem CID 157381278) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is tert-butyl 3-[3-(trifluoromethyl)phenyl]propanoate.
| Compound Name | tert-butyl 3-[3-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 157381278 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | tert-butyl 3-[3-(trifluoromethyl)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3O2/c1-13(2,3)19-12(18)8-7-10-5-4-6-11(9-10)14(15,16)17/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | BINDZTRIUXZKTR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |