C17H23F3N2O4 — CID 66629338
[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl] 5-[3-(trifluoromethyl)phenyl]pentanoate (PubChem CID 66629338) has the molecular formula C17H23F3N2O4 and a molecular weight of 376.38 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl] 5-[3-(trifluoromethyl)phenyl]pentanoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl] 5-[3-(trifluoromethyl)phenyl]pentanoate |
|---|---|
| PubChem CID | 66629338 |
| Molecular Formula | C17H23F3N2O4 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl] 5-[3-(trifluoromethyl)phenyl]pentanoate |
| SMILES | CC(C)(C)OC(=O)NNOC(=O)CCCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2O4/c1-16(2,3)25-15(24)21-22-26-14(23)10-5-4-7-12-8-6-9-13(11-12)17(18,19)20/h6,8-9,11,22H,4-5,7,10H2,1-3H3,(H,21,24) |
| InChIKey | GQHKYOVVWCUMSR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|