C23H26F3NO3 — CID 123993064
tert-butyl N-[4-oxo-4-[2-[[3-(trifluoromethyl)phenyl]methyl]phenyl]butyl]carbamate (PubChem CID 123993064) has the molecular formula C23H26F3NO3 and a molecular weight of 421.46 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-[2-[[3-(trifluoromethyl)phenyl]methyl]phenyl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-[2-[[3-(trifluoromethyl)phenyl]methyl]phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 123993064 |
| Molecular Formula | C23H26F3NO3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | tert-butyl N-[4-oxo-4-[2-[[3-(trifluoromethyl)phenyl]methyl]phenyl]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)c1ccccc1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H26F3NO3/c1-22(2,3)30-21(29)27-13-7-12-20(28)19-11-5-4-9-17(19)14-16-8-6-10-18(15-16)23(24,25)26/h4-6,8-11,15H,7,12-14H2,1-3H3,(H,27,29) |
| InChIKey | IISAKBJZWSXZTM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|