C36H43F3N4O6 — CID 67157393
benzyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-[[2-[3-(trifluoromethyl)anilino]benzoyl]amino]propylcarbamoyl]hexanoate (PubChem CID 67157393) has the molecular formula C36H43F3N4O6 and a molecular weight of 684.76 g/mol. Its IUPAC name is benzyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-[[2-[3-(trifluoromethyl)anilino]benzoyl]amino]propylcarbamoyl]hexanoate.
| Compound Name | benzyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-[[2-[3-(trifluoromethyl)anilino]benzoyl]amino]propylcarbamoyl]hexanoate |
|---|---|
| PubChem CID | 67157393 |
| Molecular Formula | C36H43F3N4O6 |
| Molecular Weight | 684.76 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | benzyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-[[2-[3-(trifluoromethyl)anilino]benzoyl]amino]propylcarbamoyl]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(C(=O)NCCCNC(=O)c1ccccc1Nc1cccc(C(F)(F)F)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H43F3N4O6/c1-35(2,3)49-34(47)42-20-10-9-18-29(33(46)48-24-25-13-5-4-6-14-25)32(45)41-22-12-21-40-31(44)28-17-7-8-19-30(28)43-27-16-11-15-26(23-27)36(37,38)39/h4-8,11,13-17,19,23,29,43H,9-10,12,18,20-22,24H2,1-3H3,(H,40,44)(H,41,45)(H,42,47) |
| InChIKey | RRUBSUOVNIXDIZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.76 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|