C21H20F3N3O3 — CID 56558972
N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-[3-(trifluoromethyl)anilino]benzamide (PubChem CID 56558972) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-[3-(trifluoromethyl)anilino]benzamide.
| Compound Name | N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-[3-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 56558972 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-2-[3-(trifluoromethyl)anilino]benzamide |
| SMILES | O=C(NCCCN1C(=O)CCC1=O)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F3N3O3/c22-21(23,24)14-5-3-6-15(13-14)26-17-8-2-1-7-16(17)20(30)25-11-4-12-27-18(28)9-10-19(27)29/h1-3,5-8,13,26H,4,9-12H2,(H,25,30) |
| InChIKey | LSIABSXEWIHFPM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|