C17H14F3NO4 — CID 16619639
(2-methoxy-2-oxoethyl) 2-[3-(trifluoromethyl)anilino]benzoate (PubChem CID 16619639) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-[3-(trifluoromethyl)anilino]benzoate.
| Compound Name | (2-methoxy-2-oxoethyl) 2-[3-(trifluoromethyl)anilino]benzoate |
|---|---|
| PubChem CID | 16619639 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-[3-(trifluoromethyl)anilino]benzoate |
| SMILES | COC(=O)COC(=O)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3NO4/c1-24-15(22)10-25-16(23)13-7-2-3-8-14(13)21-12-6-4-5-11(9-12)17(18,19)20/h2-9,21H,10H2,1H3 |
| InChIKey | OWVUHZXIZQKBSL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |