C25H23F3N2O3 — CID 2347853
[2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-[3-(trifluoromethyl)anilino]benzoate (PubChem CID 2347853) has the molecular formula C25H23F3N2O3 and a molecular weight of 456.46 g/mol. Its IUPAC name is [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-[3-(trifluoromethyl)anilino]benzoate.
| Compound Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-[3-(trifluoromethyl)anilino]benzoate |
|---|---|
| PubChem CID | 2347853 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-[3-(trifluoromethyl)anilino]benzoate |
| SMILES | CC(C)c1ccccc1NC(=O)COC(=O)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H23F3N2O3/c1-16(2)19-10-3-5-12-21(19)30-23(31)15-33-24(32)20-11-4-6-13-22(20)29-18-9-7-8-17(14-18)25(26,27)28/h3-14,16,29H,15H2,1-2H3,(H,30,31) |
| InChIKey | OVIPZYXEAZUSNS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |