C18H16F3N3O4 — CID 8789976
[2-(2-acetylhydrazinyl)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]benzoate (PubChem CID 8789976) has the molecular formula C18H16F3N3O4 and a molecular weight of 395.34 g/mol. Its IUPAC name is [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]benzoate.
| Compound Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]benzoate |
|---|---|
| PubChem CID | 8789976 |
| Molecular Formula | C18H16F3N3O4 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [2-(2-acetylhydrazinyl)-2-oxoethyl] 2-[3-(trifluoromethyl)anilino]benzoate |
| SMILES | CC(=O)NNC(=O)COC(=O)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3N3O4/c1-11(25)23-24-16(26)10-28-17(27)14-7-2-3-8-15(14)22-13-6-4-5-12(9-13)18(19,20)21/h2-9,22H,10H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | FLASRWFROSEDEE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|