C21H16F3NO3 — CID 11596190
(2-methoxyphenyl) 2-[3-(trifluoromethyl)anilino]benzoate (PubChem CID 11596190) has the molecular formula C21H16F3NO3 and a molecular weight of 387.36 g/mol. Its IUPAC name is (2-methoxyphenyl) 2-[3-(trifluoromethyl)anilino]benzoate.
| Compound Name | (2-methoxyphenyl) 2-[3-(trifluoromethyl)anilino]benzoate |
|---|---|
| PubChem CID | 11596190 |
| Molecular Formula | C21H16F3NO3 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (2-methoxyphenyl) 2-[3-(trifluoromethyl)anilino]benzoate |
| SMILES | COc1ccccc1OC(=O)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H16F3NO3/c1-27-18-11-4-5-12-19(18)28-20(26)16-9-2-3-10-17(16)25-15-8-6-7-14(13-15)21(22,23)24/h2-13,25H,1H3 |
| InChIKey | PLXAJFRBFFKUAJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|